C10H18N2O3S — CID 60780380
methyl 3-methyl-2-(1,3-thiazolidine-4-carbonylamino)butanoate (PubChem CID 60780380) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is methyl 3-methyl-2-(1,3-thiazolidine-4-carbonylamino)butanoate.
| Compound Name | methyl 3-methyl-2-(1,3-thiazolidine-4-carbonylamino)butanoate |
|---|---|
| PubChem CID | 60780380 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | methyl 3-methyl-2-(1,3-thiazolidine-4-carbonylamino)butanoate |
| SMILES | COC(=O)C(NC(=O)C1CSCN1)C(C)C |
| InChI | InChI=1S/C10H18N2O3S/c1-6(2)8(10(14)15-3)12-9(13)7-4-16-5-11-7/h6-8,11H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | GKWAMOBJIZPNMM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |