C11H20N2OS — CID 81391197
N-[(1S)-1-cyclopentylethyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 81391197) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is N-[(1S)-1-cyclopentylethyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[(1S)-1-cyclopentylethyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 81391197 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-[(1S)-1-cyclopentylethyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | C[C@H](NC(=O)C1CSCN1)C1CCCC1 |
| InChI | InChI=1S/C11H20N2OS/c1-8(9-4-2-3-5-9)13-11(14)10-6-15-7-12-10/h8-10,12H,2-7H2,1H3,(H,13,14)/t8-,10?/m0/s1 |
| InChIKey | PNDWTWVURUHKHN-PEHGTWAWSA-N |
| XLogP | 1.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |