C7H13N3O2S — CID 43553640
N-(3-amino-3-oxopropyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43553640) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43553640 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | NC(=O)CCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C7H13N3O2S/c8-6(11)1-2-9-7(12)5-3-13-4-10-5/h5,10H,1-4H2,(H2,8,11)(H,9,12) |
| InChIKey | HYTAHBFBKRTWJB-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |