C14H19N3O2S — CID 119310941
N-[3-(benzylamino)-3-oxopropyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 119310941) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[3-(benzylamino)-3-oxopropyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[3-(benzylamino)-3-oxopropyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119310941 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[3-(benzylamino)-3-oxopropyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(CCNC(=O)C1CSCN1)NCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O2S/c18-13(16-8-11-4-2-1-3-5-11)6-7-15-14(19)12-9-20-10-17-12/h1-5,12,17H,6-10H2,(H,15,19)(H,16,18) |
| InChIKey | IRBVJWSPMPJABO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |