C14H16N4O2S — CID 136811645
N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 136811645) has the molecular formula C14H16N4O2S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 136811645 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(NCCc1nc2ccccc2c(=O)[nH]1)C1CSCN1 |
| InChI | InChI=1S/C14H16N4O2S/c19-13-9-3-1-2-4-10(9)17-12(18-13)5-6-15-14(20)11-7-21-8-16-11/h1-4,11,16H,5-8H2,(H,15,20)(H,17,18,19) |
| InChIKey | GZQOHMUAPXXNCW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |