C23H21N3O3 — CID 137242270
2-(5-oxo-2-phenylcyclopenten-1-yl)-N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]acetamide (PubChem CID 137242270) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-(5-oxo-2-phenylcyclopenten-1-yl)-N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]acetamide.
| Compound Name | 2-(5-oxo-2-phenylcyclopenten-1-yl)-N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 137242270 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(5-oxo-2-phenylcyclopenten-1-yl)-N-[2-(4-oxo-3H-quinazolin-2-yl)ethyl]acetamide |
| SMILES | O=C(CC1=C(c2ccccc2)CCC1=O)NCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H21N3O3/c27-20-11-10-16(15-6-2-1-3-7-15)18(20)14-22(28)24-13-12-21-25-19-9-5-4-8-17(19)23(29)26-21/h1-9H,10-14H2,(H,24,28)(H,25,26,29) |
| InChIKey | BFDDIYNCOXSNHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |