C21H20ClN3O4 — CID 135831616
[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135831616) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135831616 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc2ccccc2c(=O)[nH]1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O4/c22-15-7-5-14(6-8-15)11-12-23-19(26)13-29-20(27)10-9-18-24-17-4-2-1-3-16(17)21(28)25-18/h1-8H,9-13H2,(H,23,26)(H,24,25,28) |
| InChIKey | ONJUQIDVKYZITP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |