C20H16Cl2N2O3 — CID 9009331
[2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate (PubChem CID 9009331) has the molecular formula C20H16Cl2N2O3 and a molecular weight of 403.27 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 9009331 |
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [2-[2-(4-chlorophenyl)ethylamino]-2-oxoethyl] 2-chloroquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)nc2ccccc12)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O3/c21-14-7-5-13(6-8-14)9-10-23-19(25)12-27-20(26)16-11-18(22)24-17-4-2-1-3-15(16)17/h1-8,11H,9-10,12H2,(H,23,25) |
| InChIKey | QVYZCZYVEKTZDC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|