C25H16Cl4N2O3 — CID 2370691
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 2370691) has the molecular formula C25H16Cl4N2O3 and a molecular weight of 534.23 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2370691 |
| Molecular Formula | C25H16Cl4N2O3 |
| Molecular Weight | 534.23 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccc(Cl)c(Cl)c2Cl)nc2ccccc12)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16Cl4N2O3/c26-15-7-5-14(6-8-15)12-30-22(32)13-34-25(33)18-11-21(31-20-4-2-1-3-16(18)20)17-9-10-19(27)24(29)23(17)28/h1-11H,12-13H2,(H,30,32) |
| InChIKey | ATHCZPQVGCWLPZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.23 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|