C19H13Cl3N2O3 — CID 16529232
[2-(methylamino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate (PubChem CID 16529232) has the molecular formula C19H13Cl3N2O3 and a molecular weight of 423.68 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16529232 |
| Molecular Formula | C19H13Cl3N2O3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(2,3,4-trichlorophenyl)quinoline-4-carboxylate |
| SMILES | CNC(=O)COC(=O)c1cc(-c2ccc(Cl)c(Cl)c2Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H13Cl3N2O3/c1-23-16(25)9-27-19(26)12-8-15(24-14-5-3-2-4-10(12)14)11-6-7-13(20)18(22)17(11)21/h2-8H,9H2,1H3,(H,23,25) |
| InChIKey | RBGLKWAMHFELBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|