C18H13ClN2O3 — CID 2373664
(2-amino-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 2373664) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2373664 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | NC(=O)COC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H13ClN2O3/c19-14-7-3-1-6-12(14)16-9-13(18(23)24-10-17(20)22)11-5-2-4-8-15(11)21-16/h1-9H,10H2,(H2,20,22) |
| InChIKey | QJLHQNACSPKPIS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |