C24H19ClN4O3 — CID 30395614
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 30395614) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 30395614 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C24H19ClN4O3/c25-20-9-3-1-8-18(20)22-15-19(17-7-2-4-10-21(17)28-22)24(31)32-16-23(30)29(13-5-11-26)14-6-12-27/h1-4,7-10,15H,5-6,13-14,16H2 |
| InChIKey | XLLNLOBCGJULHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |