C19H12ClN3O3 — CID 17493068
1,2,4-oxadiazol-3-ylmethyl 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 17493068) has the molecular formula C19H12ClN3O3 and a molecular weight of 365.78 g/mol. Its IUPAC name is 1,2,4-oxadiazol-3-ylmethyl 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | 1,2,4-oxadiazol-3-ylmethyl 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 17493068 |
| Molecular Formula | C19H12ClN3O3 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1,2,4-oxadiazol-3-ylmethyl 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(OCc1ncon1)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H12ClN3O3/c20-15-7-3-1-6-13(15)17-9-14(12-5-2-4-8-16(12)22-17)19(24)25-10-18-21-11-26-23-18/h1-9,11H,10H2 |
| InChIKey | VAWCKCHDPPCSQR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |