C22H20ClNO4 — CID 16569056
(2-butoxy-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 16569056) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | (2-butoxy-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 16569056 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2-butoxy-2-oxoethyl) 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | CCCCOC(=O)COC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H20ClNO4/c1-2-3-12-27-21(25)14-28-22(26)17-13-20(16-9-4-6-10-18(16)23)24-19-11-7-5-8-15(17)19/h4-11,13H,2-3,12,14H2,1H3 |
| InChIKey | BXSIQKHOMFJKMN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|