C26H20ClNO3 — CID 126186565
[(2S)-1-oxo-1-phenylbutan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 126186565) has the molecular formula C26H20ClNO3 and a molecular weight of 429.90 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylbutan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | [(2S)-1-oxo-1-phenylbutan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 126186565 |
| Molecular Formula | C26H20ClNO3 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [(2S)-1-oxo-1-phenylbutan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | CC[C@H](OC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H20ClNO3/c1-2-24(25(29)17-10-4-3-5-11-17)31-26(30)20-16-23(19-13-6-8-14-21(19)27)28-22-15-9-7-12-18(20)22/h3-16,24H,2H2,1H3/t24-/m0/s1 |
| InChIKey | WBLZSUBZUCTOJA-DEOSSOPVSA-N |
| XLogP | 6.37 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |