C24H23ClN2O3 — CID 7765895
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 7765895) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7765895 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-15(23(28)26-16-8-2-3-9-16)30-24(29)19-14-22(18-11-4-6-12-20(18)25)27-21-13-7-5-10-17(19)21/h4-7,10-16H,2-3,8-9H2,1H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | QUHVVJMKMUUHTO-HNNXBMFYSA-N |
| XLogP | 5.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |