C26H18ClN3O3 — CID 135928214
[(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate (PubChem CID 135928214) has the molecular formula C26H18ClN3O3 and a molecular weight of 455.90 g/mol. Its IUPAC name is [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 135928214 |
| Molecular Formula | C26H18ClN3O3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [(1R)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(2-chlorophenyl)quinoline-4-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc(-c2ccccc2Cl)nc2ccccc12)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H18ClN3O3/c1-15(24-29-22-13-7-4-10-18(22)25(31)30-24)33-26(32)19-14-23(17-9-2-5-11-20(17)27)28-21-12-6-3-8-16(19)21/h2-15H,1H3,(H,29,30,31)/t15-/m1/s1 |
| InChIKey | UFZFWRZAJGLUPP-OAHLLOKOSA-N |
| XLogP | 5.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |