C19H15N3O3 — CID 135890278
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(cyanomethyl)benzoate (PubChem CID 135890278) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(cyanomethyl)benzoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(cyanomethyl)benzoate |
|---|---|
| PubChem CID | 135890278 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] 2-(cyanomethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1CC#N)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H15N3O3/c1-12(17-21-16-9-5-4-8-15(16)18(23)22-17)25-19(24)14-7-3-2-6-13(14)10-11-20/h2-9,12H,10H2,1H3,(H,21,22,23)/t12-/m0/s1 |
| InChIKey | IXTGUIRGXMLOFI-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |