C35H26N2O5 — CID 3583187
(1-oxo-1-phenylbutan-2-yl) 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 3583187) has the molecular formula C35H26N2O5 and a molecular weight of 554.60 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylbutan-2-yl) 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3583187 |
| Molecular Formula | C35H26N2O5 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) 2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | CCC(OC(=O)c1cc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)nc2ccc(C)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H26N2O5/c1-3-31(32(38)23-9-5-4-6-10-23)42-35(41)28-20-30(36-29-18-13-21(2)19-27(28)29)22-14-16-24(17-15-22)37-33(39)25-11-7-8-12-26(25)34(37)40/h4-20,31H,3H2,1-2H3 |
| InChIKey | MUWJBRXIQWKLBA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|