C35H24BrClN2O5 — CID 5048982
(1-oxo-1-phenylbutan-2-yl) 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5048982) has the molecular formula C35H24BrClN2O5 and a molecular weight of 667.94 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5048982 |
| Molecular Formula | C35H24BrClN2O5 |
| Molecular Weight | 667.94 g/mol |
| Exact Mass | 666.06 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) 6-bromo-7-chloro-2-[4-(1,3-dioxoisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | CCC(OC(=O)c1cc(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2)nc2c(C)c(Cl)c(Br)cc12)C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H24BrClN2O5/c1-3-29(32(40)21-9-5-4-6-10-21)44-35(43)26-18-28(38-31-19(2)30(37)27(36)17-25(26)31)20-13-15-22(16-14-20)39-33(41)23-11-7-8-12-24(23)34(39)42/h4-18,29H,3H2,1-2H3 |
| InChIKey | HJWMOTINUBVJET-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.94 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|