C35H30BrClN2O5 — CID 4647578
(1-oxo-1-phenylpropan-2-yl) 6-bromo-7-chloro-8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4647578) has the molecular formula C35H30BrClN2O5 and a molecular weight of 673.99 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 6-bromo-7-chloro-8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 6-bromo-7-chloro-8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4647578 |
| Molecular Formula | C35H30BrClN2O5 |
| Molecular Weight | 673.99 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 6-bromo-7-chloro-8-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1c(Cl)c(Br)cc2c(C(=O)OC(C)C(=O)c3ccccc3)cc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C35H30BrClN2O5/c1-18-9-14-24-26(15-18)34(42)39(33(24)41)23-12-10-21(11-13-23)29-17-27(25-16-28(36)30(37)19(2)31(25)38-29)35(43)44-20(3)32(40)22-7-5-4-6-8-22/h4-8,10-13,16-18,20,24,26H,9,14-15H2,1-3H3 |
| InChIKey | XWTGQVDVIMVRFE-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.99 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|