C34H30N2O5 — CID 5002694
(1-oxo-1-phenylpropan-2-yl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 5002694) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 5002694 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1cccc2c(C(=O)OC(C)C(=O)c3ccccc3)cc(-c3ccc(N4C(=O)C5CCCCC5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H30N2O5/c1-20-9-8-14-25-28(34(40)41-21(2)31(37)23-10-4-3-5-11-23)19-29(35-30(20)25)22-15-17-24(18-16-22)36-32(38)26-12-6-7-13-27(26)33(36)39/h3-5,8-11,14-19,21,26-27H,6-7,12-13H2,1-2H3 |
| InChIKey | NTNGEVGCBSQATK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|