C35H27ClN2O5 — CID 5233366
(1-oxo-1-phenylpropan-2-yl) 8-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5233366) has the molecular formula C35H27ClN2O5 and a molecular weight of 591.06 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 8-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 8-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5233366 |
| Molecular Formula | C35H27ClN2O5 |
| Molecular Weight | 591.06 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 8-chloro-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OC(C)C(=O)c5ccccc5)c5cccc(Cl)c5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C35H27ClN2O5/c1-18-15-22-16-25(18)30-29(22)33(40)38(34(30)41)23-13-11-20(12-14-23)28-17-26(24-9-6-10-27(36)31(24)37-28)35(42)43-19(2)32(39)21-7-4-3-5-8-21/h3-15,17,19,22,25,29-30H,16H2,1-2H3 |
| InChIKey | GMANOPDPHRYBGD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.06 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|