C41H32N2O5 — CID 4161701
[2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4161701) has the molecular formula C41H32N2O5 and a molecular weight of 632.72 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4161701 |
| Molecular Formula | C41H32N2O5 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(8-methyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1=CC2CC1C1C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5ccc(-c6ccccc6)cc5)c5cccc(C)c5n4)cc3)C(=O)C21 |
| InChI | InChI=1S/C41H32N2O5/c1-23-7-6-10-31-33(41(47)48-22-35(44)28-13-11-26(12-14-28)25-8-4-3-5-9-25)21-34(42-38(23)31)27-15-17-30(18-16-27)43-39(45)36-29-19-24(2)32(20-29)37(36)40(43)46/h3-19,21,29,32,36-37H,20,22H2,1-2H3 |
| InChIKey | KEZPIMZQKNZWLR-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|