C40H32N2O5 — CID 3379588
[2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3379588) has the molecular formula C40H32N2O5 and a molecular weight of 620.71 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3379588 |
| Molecular Formula | C40H32N2O5 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 8-methyl-2-[4-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1cccc2c(C(=O)OCC(=O)c3ccc(-c4ccccc4)cc3)cc(-c3ccc(N4C(=O)C5CC=CC(C)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C40H32N2O5/c1-24-8-6-13-32-36(24)39(45)42(38(32)44)30-20-18-28(19-21-30)34-22-33(31-12-7-9-25(2)37(31)41-34)40(46)47-23-35(43)29-16-14-27(15-17-29)26-10-4-3-5-11-26/h3-12,14-22,24,32,36H,13,23H2,1-2H3 |
| InChIKey | QFVPMXWHPQKXPQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|