C30H25NO5 — CID 1216954
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 1216954) has the molecular formula C30H25NO5 and a molecular weight of 479.53 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 1216954 |
| Molecular Formula | C30H25NO5 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[(3aR,4S,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | C[C@H]1C=CC[C@@H]2C(=O)N(c3ccc(C(=O)OCC(=O)c4ccc(-c5ccccc5)cc4)cc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C30H25NO5/c1-19-6-5-9-25-27(19)29(34)31(28(25)33)24-16-14-23(15-17-24)30(35)36-18-26(32)22-12-10-21(11-13-22)20-7-3-2-4-8-20/h2-8,10-17,19,25,27H,9,18H2,1H3/t19-,25-,27+/m0/s1 |
| InChIKey | ADOZJXDBDKWGTP-YDOVEJIGSA-N |
| XLogP | 5.09 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|