C24H20ClNO5 — CID 1216957
[2-(4-chlorophenyl)-2-oxoethyl] 3-[(3aS,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate (PubChem CID 1216957) has the molecular formula C24H20ClNO5 and a molecular weight of 437.88 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 3-[(3aS,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[(3aS,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 1216957 |
| Molecular Formula | C24H20ClNO5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[(3aS,4R,7aR)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzoate |
| SMILES | C[C@@H]1C=CC[C@H]2C(=O)N(c3cccc(C(=O)OCC(=O)c4ccc(Cl)cc4)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C24H20ClNO5/c1-14-4-2-7-19-21(14)23(29)26(22(19)28)18-6-3-5-16(12-18)24(30)31-13-20(27)15-8-10-17(25)11-9-15/h2-6,8-12,14,19,21H,7,13H2,1H3/t14-,19-,21+/m1/s1 |
| InChIKey | YGJHETJKGOEWDE-MMACOIQUSA-N |
| XLogP | 4.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|