C26H20ClNO5 — CID 98127033
[2-(4-chlorophenyl)-2-oxoethyl] 3-[(1R,2R,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate (PubChem CID 98127033) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 3-[(1R,2R,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[(1R,2R,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
|---|---|
| PubChem CID | 98127033 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 3-[(1R,2R,6R,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@H]5C[C@H]45)[C@H]3C2=O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20ClNO5/c27-15-6-4-13(5-7-15)21(29)12-33-26(32)14-2-1-3-16(10-14)28-24(30)22-17-8-9-18(20-11-19(17)20)23(22)25(28)31/h1-10,17-20,22-23H,11-12H2/t17-,18-,19-,20-,22-,23-/m1/s1 |
| InChIKey | ZAOVROQWEBYQRC-MTMVXOAJSA-N |
| XLogP | 3.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|