C32H24N2O8 — CID 100810045
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 3-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate (PubChem CID 100810045) has the molecular formula C32H24N2O8 and a molecular weight of 564.55 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 3-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 3-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
|---|---|
| PubChem CID | 100810045 |
| Molecular Formula | C32H24N2O8 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 3-[(1R,2S,6R,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@@H]5C[C@H]45)[C@@H]3C2=O)c1)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C32H24N2O8/c35-27(17-4-8-21(9-5-17)42-22-10-6-19(7-11-22)34(39)40)16-41-32(38)18-2-1-3-20(14-18)33-30(36)28-23-12-13-24(26-15-25(23)26)29(28)31(33)37/h1-14,23-26,28-29H,15-16H2/t23-,24-,25-,26+,28-,29+/m1/s1 |
| InChIKey | IBFFTUIKNDZGRC-HITNAYAXSA-N |
| XLogP | 4.98 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|