C28H25NO5 — CID 124716030
[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate (PubChem CID 124716030) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
|---|---|
| PubChem CID | 124716030 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2cccc(N3C(=O)[C@@H]4[C@H]5C=C[C@@H]([C@@H]6C[C@@H]56)[C@H]4C3=O)c2)c1 |
| InChI | InChI=1S/C28H25NO5/c1-14-6-7-15(2)20(10-14)23(30)13-34-28(33)16-4-3-5-17(11-16)29-26(31)24-18-8-9-19(22-12-21(18)22)25(24)27(29)32/h3-11,18-19,21-22,24-25H,12-13H2,1-2H3/t18-,19-,21-,22-,24+,25+/m0/s1 |
| InChIKey | QFZLMPBGQWLBQJ-SQRYLOHGSA-N |
| XLogP | 3.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|