C26H23Br2NO5 — CID 98277287
[2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 98277287) has the molecular formula C26H23Br2NO5 and a molecular weight of 589.28 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 98277287 |
| Molecular Formula | C26H23Br2NO5 |
| Molecular Weight | 589.28 g/mol |
| Exact Mass | 586.99 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 3-[(1R,2S,6S,7R,8S,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2cccc(N3C(=O)[C@@H]4[C@H]5C[C@@H]([C@@H](Br)[C@H]5Br)[C@H]4C3=O)c2)c1 |
| InChI | InChI=1S/C26H23Br2NO5/c1-12-6-7-13(2)16(8-12)19(30)11-34-26(33)14-4-3-5-15(9-14)29-24(31)20-17-10-18(21(20)25(29)32)23(28)22(17)27/h3-9,17-18,20-23H,10-11H2,1-2H3/t17-,18-,20-,21-,22-,23+/m1/s1 |
| InChIKey | NGEQYPKGUDSINL-ZOGCLFRTSA-N |
| XLogP | 4.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|