C24H21Br2NO5 — CID 98339685
[2-(4-methylphenyl)-2-oxoethyl] 3-[(3aS,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 98339685) has the molecular formula C24H21Br2NO5 and a molecular weight of 563.24 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 3-[(3aS,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 3-[(3aS,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 98339685 |
| Molecular Formula | C24H21Br2NO5 |
| Molecular Weight | 563.24 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 3-[(3aS,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cccc(N3C(=O)[C@H]4C[C@H](Br)[C@@H](Br)C[C@H]4C3=O)c2)cc1 |
| InChI | InChI=1S/C24H21Br2NO5/c1-13-5-7-14(8-6-13)21(28)12-32-24(31)15-3-2-4-16(9-15)27-22(29)17-10-19(25)20(26)11-18(17)23(27)30/h2-9,17-20H,10-12H2,1H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | JUFLTTLNXCTGTK-YRPNKDGESA-N |
| XLogP | 4.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|