C36H31NO8S — CID 4680543
[2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 4680543) has the molecular formula C36H31NO8S and a molecular weight of 637.71 g/mol. Its IUPAC name is [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 4680543 |
| Molecular Formula | C36H31NO8S |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | [2-[4-(4-methylphenyl)sulfonyloxyphenyl]-2-oxoethyl] 3-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(=O)COC(=O)c3cccc(N4C(=O)C5CCC(c6ccccc6)CC5C4=O)c3)cc2)cc1 |
| InChI | InChI=1S/C36H31NO8S/c1-23-10-17-30(18-11-23)46(42,43)45-29-15-12-25(13-16-29)33(38)22-44-36(41)27-8-5-9-28(20-27)37-34(39)31-19-14-26(21-32(31)35(37)40)24-6-3-2-4-7-24/h2-13,15-18,20,26,31-32H,14,19,21-22H2,1H3 |
| InChIKey | ZEGQKFMTSXBWAP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|