C29H24BrNO5 — CID 4265830
[2-(4-bromophenyl)-2-oxoethyl] 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 4265830) has the molecular formula C29H24BrNO5 and a molecular weight of 546.42 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 4265830 |
| Molecular Formula | C29H24BrNO5 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)C3CCC(c4ccccc4)CC3C2=O)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H24BrNO5/c30-22-11-6-19(7-12-22)26(32)17-36-29(35)20-8-13-23(14-9-20)31-27(33)24-15-10-21(16-25(24)28(31)34)18-4-2-1-3-5-18/h1-9,11-14,21,24-25H,10,15-17H2 |
| InChIKey | QISFBYFHIFTZBB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|