C29H25NO5 — CID 92543039
phenacyl 3-[(3aR,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 92543039) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is phenacyl 3-[(3aR,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | phenacyl 3-[(3aR,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 92543039 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | phenacyl 3-[(3aR,5R,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)[C@@H]3CC[C@@H](c4ccccc4)C[C@H]3C2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO5/c31-26(20-10-5-2-6-11-20)18-35-29(34)22-12-7-13-23(16-22)30-27(32)24-15-14-21(17-25(24)28(30)33)19-8-3-1-4-9-19/h1-13,16,21,24-25H,14-15,17-18H2/t21-,24-,25-/m1/s1 |
| InChIKey | ZFCSJNQKJMSEKJ-NQHRYMMQSA-N |
| XLogP | 4.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|