C29H24FNO5 — CID 100808337
[2-(4-fluorophenyl)-2-oxoethyl] 3-[(3aS,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate (PubChem CID 100808337) has the molecular formula C29H24FNO5 and a molecular weight of 485.51 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-[(3aS,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(3aS,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 100808337 |
| Molecular Formula | C29H24FNO5 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-[(3aS,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)[C@H]3C[C@@H](c4ccccc4)CC[C@H]3C2=O)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H24FNO5/c30-22-12-9-19(10-13-22)26(32)17-36-29(35)21-7-4-8-23(15-21)31-27(33)24-14-11-20(16-25(24)28(31)34)18-5-2-1-3-6-18/h1-10,12-13,15,20,24-25H,11,14,16-17H2/t20-,24+,25-/m0/s1 |
| InChIKey | PIZLGFNLLCQXQH-AMDXRBSFSA-N |
| XLogP | 4.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|