C24H25NO4 — CID 19644834
propyl 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate (PubChem CID 19644834) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is propyl 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate.
| Compound Name | propyl 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19644834 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | propyl 4-(1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)benzoate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)C3CCC(c4ccccc4)CC3C2=O)cc1 |
| InChI | InChI=1S/C24H25NO4/c1-2-14-29-24(28)17-8-11-19(12-9-17)25-22(26)20-13-10-18(15-21(20)23(25)27)16-6-4-3-5-7-16/h3-9,11-12,18,20-21H,2,10,13-15H2,1H3 |
| InChIKey | CZIWEHUUTUXTLE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|