C24H22BrNO5 — CID 98165913
[2-(4-bromophenyl)-2-oxoethyl] 2-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 98165913) has the molecular formula C24H22BrNO5 and a molecular weight of 484.35 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 98165913 |
| Molecular Formula | C24H22BrNO5 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(3aR,5S,7aR)-1,3-dioxo-5-phenyl-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@@H]2CC[C@H](c3ccccc3)C[C@H]2C1=O)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H22BrNO5/c25-18-9-6-16(7-10-18)21(27)14-31-22(28)13-26-23(29)19-11-8-17(12-20(19)24(26)30)15-4-2-1-3-5-15/h1-7,9-10,17,19-20H,8,11-14H2/t17-,19+,20+/m0/s1 |
| InChIKey | GZNFJSDGERIDDW-DFQSSKMNSA-N |
| XLogP | 3.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|