C26H25NO5 — CID 98280614
[2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 98280614) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 98280614 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | Cc1ccc(C(=O)COC(=O)CN2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@H]3C2=O)[C@H](c2ccccc2)C4)cc1 |
| InChI | InChI=1S/C26H25NO5/c1-15-7-9-17(10-8-15)21(28)14-32-22(29)13-27-25(30)23-18-11-19(16-5-3-2-4-6-16)20(12-18)24(23)26(27)31/h2-10,18-20,23-24H,11-14H2,1H3/t18-,19-,20+,23+,24+/m0/s1 |
| InChIKey | USFAFMQIIRJSJG-XGVYZQAHSA-N |
| XLogP | 3.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|