C25H24N2O5 — CID 124793293
methyl 4-[[2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate (PubChem CID 124793293) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 4-[[2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 124793293 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 4-[[2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@H]3C2=O)[C@@H](c2ccccc2)C4)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-32-25(31)15-7-9-17(10-8-15)26-20(28)13-27-23(29)21-16-11-18(14-5-3-2-4-6-14)19(12-16)22(21)24(27)30/h2-10,16,18-19,21-22H,11-13H2,1H3,(H,26,28)/t16-,18+,19+,21+,22+/m0/s1 |
| InChIKey | WCRQSCXWTPREOC-JTYVBTRNSA-N |
| XLogP | 2.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|