C25H22BrNO5 — CID 124724698
[2-(4-bromophenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate (PubChem CID 124724698) has the molecular formula C25H22BrNO5 and a molecular weight of 496.36 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
|---|---|
| PubChem CID | 124724698 |
| Molecular Formula | C25H22BrNO5 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@@H]3C[C@@H]([C@H]2C1=O)[C@@H](c1ccccc1)C3)OCC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrNO5/c26-17-8-6-15(7-9-17)20(28)13-32-21(29)12-27-24(30)22-16-10-18(14-4-2-1-3-5-14)19(11-16)23(22)25(27)31/h1-9,16,18-19,22-23H,10-13H2/t16-,18+,19+,22+,23+/m0/s1 |
| InChIKey | ZQIUMJLZKOEGSC-GXRBAXLWSA-N |
| XLogP | 3.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|