C31H27NO5 — CID 98280802
[2-(4-methylphenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 98280802) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 98280802 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(N3C(=O)[C@@H]4[C@@H]5C[C@@H]([C@H]4C3=O)[C@H](c3ccccc3)C5)cc2)cc1 |
| InChI | InChI=1S/C31H27NO5/c1-18-7-9-20(10-8-18)26(33)17-37-31(36)21-11-13-23(14-12-21)32-29(34)27-22-15-24(19-5-3-2-4-6-19)25(16-22)28(27)30(32)35/h2-14,22,24-25,27-28H,15-17H2,1H3/t22-,24-,25+,27+,28+/m0/s1 |
| InChIKey | XNBQWOMCCDWEHP-OFEYSINESA-N |
| XLogP | 4.96 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|