C27H29NO4 — CID 19644829
pentyl 4-(3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate (PubChem CID 19644829) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is pentyl 4-(3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate.
| Compound Name | pentyl 4-(3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
|---|---|
| PubChem CID | 19644829 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | pentyl 4-(3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoate |
| SMILES | CCCCCOC(=O)c1ccc(N2C(=O)C3C4CC(c5ccccc5)C(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-2-3-7-14-32-27(31)18-10-12-20(13-11-18)28-25(29)23-19-15-21(17-8-5-4-6-9-17)22(16-19)24(23)26(28)30/h4-6,8-13,19,21-24H,2-3,7,14-16H2,1H3 |
| InChIKey | AGRKPLAKEGEWKN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|