C31H27NO5 — CID 124715764
[(2S)-1-oxo-1-phenylpropan-2-yl] 4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 124715764) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is [(2S)-1-oxo-1-phenylpropan-2-yl] 4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [(2S)-1-oxo-1-phenylpropan-2-yl] 4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 124715764 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [(2S)-1-oxo-1-phenylpropan-2-yl] 4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@H]3C2=O)[C@@H](c2ccccc2)C4)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H27NO5/c1-18(28(33)20-10-6-3-7-11-20)37-31(36)21-12-14-23(15-13-21)32-29(34)26-22-16-24(19-8-4-2-5-9-19)25(17-22)27(26)30(32)35/h2-15,18,22,24-27H,16-17H2,1H3/t18-,22-,24+,25+,26+,27+/m0/s1 |
| InChIKey | POUUQZGFKYJEAO-SDRGBNJHSA-N |
| XLogP | 5.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|