C31H26ClNO5 — CID 100808160
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-[(1S,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 100808160) has the molecular formula C31H26ClNO5 and a molecular weight of 528.00 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-[(1S,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-[(1S,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 100808160 |
| Molecular Formula | C31H26ClNO5 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] 3-[(1S,2R,6S,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]3C2=O)[C@H](c2ccccc2)C4)c1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H26ClNO5/c1-17(28(34)19-10-12-22(32)13-11-19)38-31(37)20-8-5-9-23(14-20)33-29(35)26-21-15-24(18-6-3-2-4-7-18)25(16-21)27(26)30(33)36/h2-14,17,21,24-27H,15-16H2,1H3/t17-,21+,24-,25+,26+,27-/m0/s1 |
| InChIKey | VTOYMASGFAHHIK-RSWSINCXSA-N |
| XLogP | 5.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|