C28H23ClN2O3 — CID 124722269
N-(4-chlorophenyl)-3-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide (PubChem CID 124722269) has the molecular formula C28H23ClN2O3 and a molecular weight of 470.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide.
| Compound Name | N-(4-chlorophenyl)-3-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
|---|---|
| PubChem CID | 124722269 |
| Molecular Formula | C28H23ClN2O3 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@@H]3C2=O)[C@@H](c2ccccc2)C4)c1 |
| InChI | InChI=1S/C28H23ClN2O3/c29-19-9-11-20(12-10-19)30-26(32)17-7-4-8-21(13-17)31-27(33)24-18-14-22(16-5-2-1-3-6-16)23(15-18)25(24)28(31)34/h1-13,18,22-25H,14-15H2,(H,30,32)/t18-,22+,23+,24+,25-/m0/s1 |
| InChIKey | RBGSEQTVCUGZGY-CWVZODRYSA-N |
| XLogP | 5.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|