C29H26N2O3 — CID 6567493
3-[(1R,2S,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2-methylphenyl)benzamide (PubChem CID 6567493) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-[(1R,2S,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2-methylphenyl)benzamide.
| Compound Name | 3-[(1R,2S,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 6567493 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 3-[(1R,2S,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H]3C2=O)[C@@H](c2ccccc2)C4)c1 |
| InChI | InChI=1S/C29H26N2O3/c1-17-8-5-6-13-24(17)30-27(32)19-11-7-12-21(14-19)31-28(33)25-20-15-22(18-9-3-2-4-10-18)23(16-20)26(25)29(31)34/h2-14,20,22-23,25-26H,15-16H2,1H3,(H,30,32)/t20-,22+,23+,25-,26-/m0/s1 |
| InChIKey | JCNPESVRUGUEAH-MPRXIOMQSA-N |
| XLogP | 5.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|