C22H20Br2N2O3 — CID 98339372
3-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylphenyl)benzamide (PubChem CID 98339372) has the molecular formula C22H20Br2N2O3 and a molecular weight of 520.22 g/mol. Its IUPAC name is 3-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylphenyl)benzamide.
| Compound Name | 3-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 98339372 |
| Molecular Formula | C22H20Br2N2O3 |
| Molecular Weight | 520.22 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 3-[(3aR,5S,6S,7aR)-5,6-dibromo-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(N2C(=O)[C@@H]3C[C@H](Br)[C@@H](Br)C[C@H]3C2=O)c1 |
| InChI | InChI=1S/C22H20Br2N2O3/c1-12-5-2-3-8-19(12)25-20(27)13-6-4-7-14(9-13)26-21(28)15-10-17(23)18(24)11-16(15)22(26)29/h2-9,15-18H,10-11H2,1H3,(H,25,27)/t15-,16-,17+,18+/m1/s1 |
| InChIKey | QQZKAMVUGRUVPM-BDXSIMOUSA-N |
| XLogP | 4.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|