C22H15BrN2O3 — CID 1271171
N-(4-bromo-2-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 1271171) has the molecular formula C22H15BrN2O3 and a molecular weight of 435.28 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 1271171 |
| Molecular Formula | C22H15BrN2O3 |
| Molecular Weight | 435.28 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H15BrN2O3/c1-13-11-15(23)9-10-19(13)24-20(26)14-5-4-6-16(12-14)25-21(27)17-7-2-3-8-18(17)22(25)28/h2-12H,1H3,(H,24,26) |
| InChIKey | UXOZZSWRVHQBQF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|