C25H21N7O4 — CID 19336564
N-(1,5-dimethylpyrazol-4-yl)-4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-methylpyrazole-5-carboxamide (PubChem CID 19336564) has the molecular formula C25H21N7O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336564 |
| Molecular Formula | C25H21N7O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1c(NC(=O)c2c(NC(=O)c3cccc(N4C(=O)c5ccccc5C4=O)c3)cnn2C)cnn1C |
| InChI | InChI=1S/C25H21N7O4/c1-14-19(12-26-30(14)2)28-23(34)21-20(13-27-31(21)3)29-22(33)15-7-6-8-16(11-15)32-24(35)17-9-4-5-10-18(17)25(32)36/h4-13H,1-3H3,(H,28,34)(H,29,33) |
| InChIKey | OLGGQCZPXCXWKV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|